
Catalog Number	AR005YXA
Chemical Name	1,2-Benzisoxazole-3-methanesulfonylchloride
CAS Number	73101-65-2
Molecular Formula	C8H6ClNO3S
Molecular Weight	231.6561
MDL Number	MFCD07367669
SMILES	ClS(=O)(=O)Cc1noc2c1cccc2

Benzo[d]isoxazol-3-ylmethanesulfonyl chloride is a highly versatile and valuable compound in chemical synthesis. It serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. This compound's unique structure and reactivity make it an essential reagent in the preparation of complex organic molecules, such as sulfonamides, sulfonylureas, and sulfonamide-based inhibitors. Its application as a sulfonylating agent allows for the selective functionalization of nucleophiles, enabling efficient access to diverse molecular architectures. Furthermore, the utilization of Benzo[d]isoxazol-3-ylmethanesulfonyl chloride in organic synthesis offers chemists a powerful tool for the development of novel therapeutic agents and advanced materials.

1,2-Benzisoxazole-3-methanesulfonylchloride

73101-65-2

Product Details