
Catalog Number	AR00632H
Chemical Name	Swainsonine
CAS Number	72741-87-8
Molecular Formula	C8H15NO3
Molecular Weight	173.2096
MDL Number	MFCD00017554
SMILES	O[C@@H]1CN2C([C@@H]1O)[C@H](O)CCC2
NSC Number	614553

Swainsonine is a naturally occurring indolizidine alkaloid that has garnered significant interest in chemical synthesis due to its unique properties and potential applications. This compound, derived from certain plants such as Swainsona canescens and Metaplexis japonica, has been found to exhibit inhibitory activity against several enzymes, particularly α-mannosidase enzymes.In chemical synthesis, Swainsonine is utilized for its ability to selectively inhibit α-mannosidase enzymes, which play crucial roles in glycoprotein processing and maturation. By disrupting the function of these enzymes, Swainsonine can lead to the accumulation of underprocessed glycoproteins with high-mannose structures. This property has been leveraged in the synthesis of glycoconjugates and glycoprotein mimetics for various biological and pharmaceutical applications.Furthermore, Swainsonine's inhibitory effects on α-mannosidase enzymes make it a valuable tool for studying glycoprotein biosynthesis pathways and investigating the roles of glycosylation in cellular processes. Its unique mechanism of action and specific enzyme target make Swainsonine a versatile compound in the realm of chemical synthesis, with potential implications in drug discovery, biomolecular engineering, and glycobiology research.