
Catalog Number	AR005MV9
Chemical Name	Hypaconitine
CAS Number	6900-87-4
Molecular Formula	C33H45NO10
Molecular Weight	615.7111
MDL Number	MFCD11041032
SMILES	COCC12CCC(C34C2C(OC)C(C3N(C1)C)C1(C2C4CC(C2OC(=O)c2ccccc2)(C(C1O)OC)O)OC(=O)C)OC

Hypaconitine is a naturally occurring compound that belongs to the aconitine alkaloid group. In chemical synthesis, Hypaconitine can be utilized as a key building block in the creation of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable reagent for the production of synthetic organic molecules with complex architectures.Due to its versatile nature, Hypaconitine can be employed in a range of synthetic transformations, including carbon-carbon bond formations, functional group manipulations, and stereochemical control reactions. Its use in chemical synthesis enables the construction of intricate molecular frameworks that are crucial for the development of novel drug candidates and bioactive compounds.As a chemist, utilizing Hypaconitine in chemical synthesis offers a strategic approach to accessing diverse chemical space and unlocking new pathways for the creation of biologically relevant molecules. By harnessing the synthetic potential of Hypaconitine, researchers can expand their toolkit for designing and preparing compounds with potent pharmacological properties.

Hypaconitine

6900-87-4

Product Details