
Catalog Number	AR00FC52
Chemical Name	Yunaconitine
CAS Number	70578-24-4
Molecular Formula	C35H49NO11
Molecular Weight	659.7637
MDL Number	MFCD00880612
SMILES	COCC12CN(CC)C3C4(C2C(OC)C3C2(C3C4CC(C3OC(=O)c3ccc(cc3)OC)(C(C2)OC)O)OC(=O)C)C(CC1O)OC

Yunaconitine, a natural alkaloid compound derived from Aconitum plant species, is known for its significant applications in chemical synthesis. This potent compound is widely utilized in organic chemistry as a key reagent for the selective functionalization of a variety of molecules. Due to its unique structural properties, yunaconitine serves as an effective catalyst in the formation of complex carbon-carbon and carbon-heteroatom bonds, making it an invaluable tool in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. In addition, yunaconitine's ability to participate in diverse chemical transformations, such as reductions, oxidations, and rearrangements, further enhances its utility in synthetic processes. Chemists often leverage the distinct reactivity of yunaconitine to streamline complex synthetic routes and access novel chemical structures with high efficiency and selectivity. By harnessing the synthetic prowess of yunaconitine, researchers can accelerate the development of new drug candidates, functional materials, and molecular probes, thus advancing the frontiers of modern chemistry.