
Catalog Number	AR003FOV
Chemical Name	2-(Boc-aminomethyl)benzoic acid
CAS Number	669713-61-5
Molecular Formula	C13H17NO4
Molecular Weight	251.2784
MDL Number	MFCD10565780
SMILES	O=C(OC(C)(C)C)NCc1ccccc1C(=O)O

2-(Boc-aminomethyl)benzoic acid is a versatile building block commonly used in chemical synthesis for the preparation of various pharmaceuticals, agrochemicals, and functional materials. Due to its unique structure and reactivity, this compound plays a crucial role in the synthesis of complex molecules by serving as a protected amine intermediate.In organic synthesis, the Boc group (tert-butyloxycarbonyl) on the amino functionality of 2-(Boc-aminomethyl)benzoic acid acts as a protecting group, allowing the selective manipulation of the amine group without affecting other functional groups present in the molecule. This protection-deprotection strategy is essential for controlling the regioselectivity and stereochemistry of chemical reactions, especially in the construction of challenging molecular structures.Furthermore, the benzoic acid moiety in this compound serves as a versatile handle for further functionalization through various chemical transformations, such as amide bond formation, esterification, and cross-coupling reactions. These synthetic capabilities make 2-(Boc-aminomethyl)benzoic acid a valuable precursor in the development of new drugs, advanced materials, and bioactive compounds with tailored properties and biological activities.