
Catalog Number	AR01DMJS
Chemical Name	2-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid
CAS Number	658683-23-9
Molecular Formula	C14H19NO4
Molecular Weight	265.305
MDL Number	MFCD31652834
SMILES	O=C(OC(C)(C)C)NC(c1ccccc1C(=O)O)C

2-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, also known as $name$, is a versatile compound widely utilized in chemical synthesis due to its unique properties. This compound plays a crucial role in the field of organic chemistry, particularly in the synthesis of peptide-based molecules.One of the key applications of $name$ is its use as a protecting group in peptide synthesis. As a tert-butoxycarbonyl (Boc) protected amino acid derivative, $name$ serves to block the reactive amino group during peptide chain assembly. This protective group ensures selective reactions at specific sites on the peptide chain, enabling the controlled stepwise construction of complex peptide structures.Additionally, $name$ can be employed as a precursor in the synthesis of pharmaceutical intermediates and bioactive compounds. Its functional groups provide strategic points for derivatization and modification, allowing for the introduction of diverse chemical moieties to tailor the properties of the final product. This compound's compatibility with a variety of synthetic methodologies further expands its utility in medicinal chemistry and drug discovery research.In summary, 2-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid serves as a valuable building block in chemical synthesis, offering precise control over reaction pathways and enabling the efficient production of structurally diverse molecules with potential applications in pharmaceuticals, materials science, and biotechnology.