
Catalog Number	AR003OBI
Chemical Name	ACETIC ACID (2R,3R,4R,5R)-3,4-DIACETOXY-5-(6-CHLORO-2-IODO-PURIN-9-YL)-TETRAHYDRO-FURAN-2-YLMETHYL ESTER
CAS Number	5987-76-8
Molecular Formula	C16H16ClIN4O7
Molecular Weight	538.6783
MDL Number	MFCD03701153
SMILES	CC(=O)O[C@@H]1[C@H](OC(=O)C)[C@H](O[C@H]1n1cnc2c1nc(I)nc2Cl)COC(=O)C

The compound (2R,3R,4R,5R)-2-(acetoxymethyl)-5-(6-chloro-2-iodo-9H-purin-9-yl)tetrahydrofuran-3,4-diyl diacetate is widely utilized in chemical synthesis due to its unique structural properties. In synthetic chemistry, this compound serves as a valuable building block for the creation of complex organic molecules. Its reactive acetate groups enable efficient modification and functionalization of the molecule, allowing for the synthesis of various derivatives with tailored properties. Additionally, the presence of both purine and tetrahydrofuran moieties in the structure offers opportunities for diversification and incorporation into different molecular frameworks. The compound's stereochemistry further enhances its utility in asymmetric synthesis, enabling the creation of chiral compounds with high enantiomeric purity. By utilizing (2R,3R,4R,5R)-2-(acetoxymethyl)-5-(6-chloro-2-iodo-9H-purin-9-yl)tetrahydrofuran-3,4-diyl diacetate as a key building block in chemical synthesis, researchers can efficiently access a wide range of structurally diverse and biologically relevant compounds.