
Catalog Number	AR00EC58
Chemical Name	(2R,3R,4R,5R)-2-(ACETOXYMETHYL)-5-(6-CHLORO-9H-PURIN-9-YL)TETRAHYDROFURAN-3,4-DIYL DIACETATE
CAS Number	5987-73-5
Molecular Formula	C16H17ClN4O7
Molecular Weight	412.7818
MDL Number	MFCD09841351
SMILES	CC(=O)O[C@@H]1[C@H](OC(=O)C)[C@H](O[C@H]1n1cnc2c1ncnc2Cl)COC(=O)C

The compound (2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(6-chloro-9H-purin-9-yl)tetrahydrofuran-3,4-diyl diacetate is utilized in chemical synthesis as a versatile building block for the formation of nucleoside analogs. It serves as an important intermediate in the synthesis of modified nucleosides with potential applications in drug development and molecular biology research. Additionally, this compound can participate in enzymatic reactions to introduce specific functional groups at precise positions within the nucleoside structure, enabling the creation of tailored nucleoside derivatives with diverse properties.