
Catalog Number	AR003SA6
Chemical Name	Methyl 2-(trifluoromethyl)isonicotinate
CAS Number	588702-68-5
Molecular Formula	C8H6F3NO2
Molecular Weight	205.1339
MDL Number	MFCD14698093
SMILES	COC(=O)c1ccnc(c1)C(F)(F)F

Methyl 2-(trifluoromethyl)isonicotinate is a versatile compound widely utilized in chemical synthesis as a valuable building block. Its unique structure, incorporating a trifluoromethyl group and an isonicotinate moiety, imparts specific properties that are highly sought after in the field of organic chemistry. This compound serves as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and materials due to its ability to introduce the trifluoromethyl functionality into target molecules. The trifluoromethyl group is known for significantly enhancing the potency, metabolic stability, and overall biological activity of organic compounds, making it a pivotal component in drug discovery and development. In addition, the presence of the isonicotinate group provides additional reactivity, allowing for the efficient construction of complex molecular architectures. Overall, the application of Methyl 2-(trifluoromethyl)isonicotinate in chemical synthesis enables the creation of novel compounds with diverse functionalities that are essential for advancing numerous scientific and industrial endeavors.