
Catalog Number	AR01V6WA
Chemical Name	tert-butyl 4-hydroxy-2-(methylthio)-5,8-dihydropyrido[3,4-d]pyrimidine-7(6H)-carboxylate
CAS Number	338739-81-4
Molecular Formula	C13H19N3O3S
Molecular Weight	297.3733
SMILES	CSc1nc2CN(CCc2c(n1)O)C(=O)OC(C)(C)C

The tert-Butyl 2-(methylthio)-4-oxo-4,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7(3H)-carboxylate is a versatile compound utilized in chemical synthesis for its unique properties and reactivity. In the realm of organic chemistry, this compound serves as a valuable building block for the construction of complex molecular structures. Its specific molecular configuration allows for strategic incorporation into various synthetic pathways, enabling the formation of novel compounds with potential biological or pharmaceutical significance. By leveraging the reactivity of tert-Butyl 2-(methylthio)-4-oxo-4,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7(3H)-carboxylate, chemists can access a wide array of structural motifs and functional groups, thereby expanding the possibilities for drug discovery, material science, and other areas of chemical research. This compound's role in chemical synthesis highlights its importance as a key component in the creation of diverse molecules with tailored properties and applications.