
Catalog Number	AR00DAH7
Chemical Name	(3α,5β,12α)-3,12-Dihydroxy-24-norcholan-23-oic acid
CAS Number	53608-86-9
Molecular Formula	C23H38O4
Molecular Weight	378.5454199999999
MDL Number	MFCD00076043
SMILES	O[C@@H]1CC[C@]2([C@@H](C1)CC[C@@H]1[C@@H]2C[C@H](O)[C@]2([C@H]1CC[C@@H]2[C@@H](CC(=O)O)C)C)C

Nor-Desoxycholic Acid, also known as NorDCA, is a versatile chemical compound widely used in chemical synthesis processes. This compound plays a crucial role in the manufacturing of various pharmaceuticals, particularly in the synthesis of bile acids and their derivatives. In organic chemistry, Nor-Desoxycholic Acid serves as a key intermediate in the preparation of bioactive compounds and drug molecules. Its unique chemical properties and reactivity make it a valuable building block for creating complex molecular structures with specific biological activities. Researchers and chemists utilize Nor-Desoxycholic Acid to introduce specific functional groups, modify molecular architecture, and enhance the potency of bioactive compounds. Additionally, this compound finds application in the development of novel drugs, where its structural features can be tailored to optimize pharmacological properties and biological interactions. In summary, Nor-Desoxycholic Acid is an essential ingredient in chemical synthesis, enabling the synthesis of diverse compounds with therapeutic potential and pharmaceutical relevance.