
Catalog Number	AR003OMQ
Chemical Name	Atropine
CAS Number	51-55-8
Molecular Formula	C17H23NO3
Molecular Weight	289.3694
MDL Number	MFCD00022622
SMILES	OCC(c1ccccc1)C(=O)O[C@@H]1C[C@@H]2CC[C@H](C1)N2C

Atropine, a naturally occurring tropane alkaloid derived from plants such as deadly nightshade, has a wide range of applications in chemical synthesis. In organic chemistry, Atropine is frequently employed as a chiral building block due to its unique structural features, particularly its chiral nature and the presence of multiple functional groups. One primary application of Atropine in chemical synthesis is as a chiral catalyst or resolving agent. Its chirality allows it to catalyze asymmetric reactions, where the formation of enantiomerically pure products is crucial. Atropine's ability to interact selectively with different reactants and control the stereochemistry of the products makes it valuable in producing enantiomerically pure compounds, which are essential in the pharmaceutical and fine chemical industries.In addition to its role as a chiral catalyst, Atropine is also utilized in the synthesis of pharmaceutical drugs. It can serve as a key intermediate in the production of anticholinergic medications, psychotropic drugs, and other therapeutic agents. By incorporating Atropine into various synthetic pathways, chemists can access structurally diverse molecules with potent biological activities.Furthermore, Atropine's functional groups, such as esters, aromatic rings, and tertiary amines, make it a versatile starting material for the synthesis of complex molecules. By selectively modifying these functional groups through chemical reactions like acylation, alkylation, or reduction, chemists can manipulate Atropine's structure to create novel compounds with diverse properties and applications.Overall, Atropine's significance in chemical synthesis lies in its versatility, chiral properties, and potential to serve as a building block for the creation of valuable molecules. Whether used as a chiral catalyst, pharmaceutical intermediate, or structural precursor, Atropine plays a crucial role in advancing synthetic strategies and expanding the repertoire of chemical compounds available for scientific research and industrial applications.