
Catalog Number	AR01CBW7
Chemical Name	3-Oxa-9-azoniatricyclo[3.3.1.02,4]nonane,9-(cyclopropylmethyl)-7-[(2S)-3-hydroxy-1-oxo-2-phenylpropoxy]-9-methyl-, bromide, (1a,2b,4b,5a,7b)-
CAS Number	51598-60-8
Molecular Formula	C21H28BrNO4
Molecular Weight	438.3553
MDL Number	MFCD00869708
SMILES	OC[C@H](c1ccccc1)C(=O)O[C@@H]1C[C@@H]2[C@@H]3[C@H]([C@H](C1)[N+]2(C)CC1CC1)O3.[Br-]

Cimetropium bromide is a quaternary ammonium compound that finds utility in chemical synthesis as a quaternizing agent. In organic chemistry, it is commonly employed to facilitate reactions involving nucleophilic substitution. Specifically, Cimetropium bromide serves as a strong electrophile due to its positively charged quaternary ammonium center, allowing it to efficiently react with nucleophiles such as grignard reagents and enolates. This unique reactivity enables the introduction of the Cimetropium bromide moiety into various organic scaffolds, thereby modifying their chemical properties and generating diverse molecular structures. Furthermore, the high selectivity of Cimetropium bromide in these transformations contributes to its significance in the realm of chemical synthesis.