
Catalog Number	AR005TEM
Chemical Name	1-Naphthalenecarboxaldehyde, 2,4-dimethoxy-
CAS Number	75965-84-3
Molecular Formula	C13H12O3
Molecular Weight	216.2326
MDL Number	MFCD30185873
SMILES	COc1cc(OC)c2c(c1C=O)cccc2

1-Naphthalenecarboxaldehyde, 2,4-dimethoxy-, also known as Dimethoxynaphthaldehyde, is a versatile compound widely utilized in chemical synthesis. This compound serves as a key building block in the creation of various organic molecules due to its unique structure and reactivity. In organic synthesis, 1-Naphthalenecarboxaldehyde, 2,4-dimethoxy- is commonly employed as a starting material for the preparation of functionalized naphthalene derivatives. Its aldehyde group can undergo various reactions such as condensation, reduction, and oxidation, allowing for the introduction of different functional groups and modifications to the molecular structure. Additionally, the dimethoxy substituents on the naphthalene ring provide steric hindrance and electronic effects that can influence the reactivity and selectivity of chemical transformations. Overall, the application of 1-Naphthalenecarboxaldehyde, 2,4-dimethoxy- in chemical synthesis enables the efficient and strategic construction of complex organic compounds with diverse functionalities and properties.