
Catalog Number	AR00FFSJ
Chemical Name	Isoquinoline, 8-nitro- (7CI,8CI,9CI)
CAS Number	7473-12-3
Molecular Formula	C9H6N2O2
Molecular Weight	174.1561
MDL Number	MFCD19690132
SMILES	[O-][N+](=O)c1cccc2c1cncc2

8-Nitroisoquinoline is a powerful building block in chemical synthesis, commonly utilized in the production of various specialized compounds. Its versatility lies in its ability to undergo numerous reactions, allowing for the creation of diverse molecular structures with distinct properties. One key application of 8-Nitroisoquinoline is its role in the synthesis of heterocyclic compounds, which are essential components in pharmaceuticals, agrochemicals, and materials science. By incorporating 8-Nitroisoquinoline into synthetic pathways, chemists can access unique structural motifs that are crucial for the development of novel drugs, pesticides, and advanced materials. The reactivity and stability of 8-Nitroisoquinoline make it an indispensable tool for chemists seeking to design and create complex molecules with specific functions and applications.