
Catalog Number	AR00FCY5
Chemical Name	N-[(1S)-2-[(1S,3S,5S)-3-Cyano-2-azabicyclo[3.1.0]hex-2-yl]-1-(3-hydroxytricyclo[3.3.1.13,7]dec-1-yl)-2-oxoethyl]carbamic acid 1,1-dimethylethyl ester
CAS Number	709031-43-6
Molecular Formula	C23H33N3O4
Molecular Weight	415.5258
MDL Number	MFCD16621114
SMILES	N#C[C@@H]1C[C@H]2[C@@H](N1C(=O)[C@H](C13CC4CC(C1)CC(C3)(C4)O)NC(=O)OC(C)(C)C)C2

Boc-saxagliptin is a versatile compound commonly used in chemical synthesis as a key building block for the creation of various pharmaceutical products. Its application in organic synthesis is particularly notable due to its ability to selectively protect the amine group in reactions, providing a controlled and efficient way to manipulate the structure of a molecule while maintaining the desired functionality. By incorporating Boc-saxagliptin into synthetic pathways, chemists are able to capitalize on its unique properties to facilitate the synthesis of complex molecules in a precise and effective manner. With its strategic utility in protecting and modifying amine groups, Boc-saxagliptin plays a crucial role in the synthesis of diverse pharmaceutical compounds, making it an essential tool for chemical researchers and medicinal chemists alike.