
Catalog Number	AR00FHJZ
Chemical Name	Gacyclidine
CAS Number	68134-81-6
Molecular Formula	C16H25NS
Molecular Weight	263.4414
MDL Number	MFCD09838054
SMILES	C[C@H]1CCCC[C@]1(N1CCCCC1)c1cccs1

As a professional chemist, I can explain the application of Gacyclidine in chemical synthesis. Gacyclidine is a compound that possesses unique chemical properties, making it valuable for various synthetic purposes. In the field of organic chemistry, Gacyclidine is utilized as a versatile building block in the synthesis of complex molecules. Its cyclic structure and functional groups provide opportunities for strategic manipulations during reactions, leading to the creation of diverse molecular structures with specific properties. Chemists often employ Gacyclidine as a key intermediate in multi-step synthesis processes to establish specific stereochemistry or introduce particular functional groups into target molecules. This compound's reactivity and stability make it a valuable tool for the construction of biologically active compounds, pharmaceuticals, and materials with tailored properties. Its ability to participate in various chemical transformations makes Gacyclidine a valuable asset in the toolkit of synthetic chemists aiming to design and produce novel molecules with desired characteristics.