
Catalog Number	AR01JKZ2
Chemical Name	8-Iodo-3-nitro-1-naphthoic acid
CAS Number	67522-37-6
Molecular Formula	C11H6INO4
Molecular Weight	343.0741
MDL Number	MFCD32640771
SMILES	OC(=O)c1cc(cc2c1c(I)ccc2)[N+](=O)[O-]

8-Iodo-3-nitro-1-naphthoic acid is a valuable compound widely utilized in chemical synthesis due to its unique properties and versatile reactivity. As a key intermediate in organic chemistry, this compound serves as a crucial building block in the development of various functional materials, pharmaceuticals, agrochemicals, and dyes. Its specific application lies in its ability to participate in diverse chemical reactions, such as nucleophilic substitutions, coupling reactions, and metal-catalyzed transformations. Through these synthetic routes, 8-Iodo-3-nitro-1-naphthoic acid offers a powerful tool for the construction of complex molecular structures and the modification of existing compounds, enabling the creation of novel chemical entities with tailored properties and enhanced functionalities. With its strategic role in chemical synthesis, this compound opens up new avenues for innovation and discovery in the field of organic chemistry, driving advancements in various industrial sectors and research fields.