
Catalog Number	AR00IC4H
Chemical Name	Pyrrolo[2,1-f][1,2,4]triazine, 4-chloro-5-methyl-6-(phenylmethoxy)-
CAS Number	649736-27-6
Molecular Formula	C14H12ClN3O
Molecular Weight	273.7176
MDL Number	MFCD11869899
SMILES	Clc1ncnn2c1c(C)c(c2)OCc1ccccc1

4-Chloro-5-methyl-6-(phenylmethoxy)pyrrolo[2,1-f][1,2,4]triazine is a versatile compound widely utilized in chemical synthesis. This specific molecule plays a crucial role in organic chemistry as a key building block for the development of various advanced compounds. It serves as a valuable intermediate in the creation of pharmaceuticals, agrochemicals, and materials due to its unique structural properties and reactivity. Its selective functional groups enable precise modifications and derivatizations, making it an essential component in the synthesis of complex organic molecules. Furthermore, the incorporation of 4-Chloro-5-methyl-6-(phenylmethoxy)pyrrolo[2,1-f][1,2,4]triazine in chemical reactions allows for the formation of diverse molecular architectures with specific properties tailored for various applications in the field of chemistry.