
Catalog Number	AR01DZYK
Chemical Name	tert-Butyl 3-benzylimidazolidine-1-carboxylate
CAS Number	623943-75-9
Molecular Formula	C15H22N2O2
Molecular Weight	262.3474
MDL Number	MFCD24466955
SMILES	O=C(N1CCN(C1)Cc1ccccc1)OC(C)(C)C

The tert-Butyl 3-benzylimidazolidine-1-carboxylate is a versatile compound that finds common application in chemical synthesis procedures due to its unique chemical properties. Thanks to its specific structure and reactivity, this compound acts as an efficient intermediate in the production of various pharmaceuticals, agrochemicals, and functional materials. Its presence enables the synthesis of complex molecules by participating in key reactions, including asymmetric catalysis and chiral transformations. Researchers and industrial chemists value tert-Butyl 3-benzylimidazolidine-1-carboxylate for its ability to enhance the efficiency and selectivity of synthesis processes, making it a valuable tool in the advancement of modern organic chemistry.