
Catalog Number	AR01CB9O
Chemical Name	9H-Carbazole, 1,3,6-tribromo-
CAS Number	55119-10-3
Molecular Formula	C12H6Br3N
Molecular Weight	403.8947
MDL Number	MFCD00218280
SMILES	Brc1ccc2c(c1)c1cc(Br)cc(c1[nH]2)Br

9H-Carbazole, 1,3,6-tribromo- is a crucial compound in chemical synthesis due to its versatile applications. It serves as a valuable building block in the preparation of various organic compounds and materials, particularly in the field of organic chemistry and materials science. This compound is utilized in the synthesis of pharmaceuticals, agrochemicals, polymers, and dyes. Its tribromo substitution pattern enhances its reactivity and allows for selective functionalization of the carbazole core, making it a valuable intermediate in the synthesis of complex organic molecules. The tribromo substituents also impart unique properties to the resulting compounds, making them useful in a wide range of applications.