
Catalog Number	AR003NJK
Chemical Name	5-methyl biphenyl-2-carboxylic acid
CAS Number	92254-03-0
Molecular Formula	C14H12O2
Molecular Weight	212.2439
MDL Number	MFCD14702121
SMILES	Cc1ccc(c(c1)c1ccccc1)C(=O)O

5-Methyl-[1,1'-biphenyl]-2-carboxylic acid, also known as $name$, is a crucial compound in chemical synthesis processes. This chemical plays a significant role as a versatile building block in the creation of various organic molecules and materials. Its unique structure and reactivity make it a valuable intermediate in pharmaceutical, agrochemical, and material science applications.One of the primary uses of 5-Methyl-[1,1'-biphenyl]-2-carboxylic acid in chemical synthesis is as a key starting material for the preparation of biologically active compounds. By undergoing various functional group transformations, such as acylation, esterification, and amidation, this compound can be utilized in the synthesis of pharmaceutical agents with diverse pharmacological properties.Additionally, this acid can serve as a vital component in the construction of advanced materials, including liquid crystals, polymers, and organic semiconductors. Its incorporation into the molecular structure of these materials imparts specific functionalities and desirable properties, contributing to the development of innovative technologies and products.Moreover, the versatility of 5-Methyl-[1,1'-biphenyl]-2-carboxylic acid enables its utilization in the synthesis of agrochemicals, such as pesticides and herbicides. Through strategic chemical modifications, this compound can be transformed into active ingredients that exhibit targeted effects on pests and weeds, thus enhancing the efficiency and sustainability of agricultural practices.In conclusion, the strategic application of 5-Methyl-[1,1'-biphenyl]-2-carboxylic acid in chemical synthesis serves as a fundamental pillar in the creation of diverse organic compounds with significant industrial and scientific importance. Its role as a versatile building block underscores its value in advancing various fields of chemistry and contributing to the development of novel molecules and materials.