
Catalog Number	AR0035J0
Chemical Name	4-Thiazoleacetic acid, 2-amino-α-[[2-(1,1-dimethylethoxy)-1,1-dimethyl-2-oxoethoxy]imino]-, ethyl ester, (Z)-
CAS Number	86299-46-9
Molecular Formula	C15H23N3O5S
Molecular Weight	357.4252
MDL Number	MFCD00062759
SMILES	CCOC(=O)C(=NOC(C(=O)OC(C)(C)C)(C)C)c1csc(n1)N

4-Thiazoleacetic acid, 2-amino-α-[[2-(1,1-dimethylethoxy)-1,1-dimethyl-2-oxoethoxy]imino]-, ethyl ester, (Z)- is a valuable compound in chemical synthesis, particularly in the field of organic chemistry. This compound serves as a versatile building block for the synthesis of various heterocyclic compounds and pharmaceutical intermediates. Its unique structure containing a thiazole ring and an amino group makes it a key component in the development of novel molecules with potential biological activities.In chemical synthesis, 4-Thiazoleacetic acid, 2-amino-α-[[2-(1,1-dimethylethoxy)-1,1-dimethyl-2-oxoethoxy]imino]-, ethyl ester, (Z)- can be used as a precursor in the preparation of complex molecules through various reactions such as condensation, acylation, and cyclization. Its ethyl ester form allows for easy manipulation and introduction of the compound into different synthetic pathways, enabling chemists to create structurally diverse compounds for various applications.Overall, the versatile nature of 4-Thiazoleacetic acid, 2-amino-α-[[2-(1,1-dimethylethoxy)-1,1-dimethyl-2-oxoethoxy]imino]-, ethyl ester, (Z)- makes it a valuable tool in chemical synthesis for the development of new compounds with potential pharmaceutical, agrochemical, and materials science applications.

4-Thiazoleacetic acid, 2-amino-α-[[2-(1,1-dimethylethoxy)-1,1-dimethyl-2-oxoethoxy]imino]-, ethyl ester, (Z)-

86299-46-9

Product Details