
Catalog Number	AR004Q1H
Chemical Name	3-(2-Thiazolyl)aminocarbonylphenylboronic acid
CAS Number	850567-34-9
Molecular Formula	C10H9BN2O3S
Molecular Weight	248.06606000000002
MDL Number	MFCD06659885
SMILES	O=C(c1cccc(c1)B(O)O)Nc1nccs1

The (3-(Thiazol-2-ylcarbamoyl)phenyl)boronic acid is a versatile compound used in various chemical synthesis processes. This compound acts as a valuable building block for the creation of complex organic molecules, particularly in the field of medicinal chemistry and drug development. Its unique structure allows for precise and selective binding interactions with target molecules, making it an essential tool for the design and synthesis of pharmaceutical agents. Additionally, the boronic acid functionality present in this compound enables it to participate in key reactions such as Suzuki coupling, which is widely employed in the construction of biaryl compounds. The (3-(Thiazol-2-ylcarbamoyl)phenyl)boronic acid plays a crucial role in facilitating the synthesis of bioactive compounds and can be tailored to meet specific requirements in organic synthesis.