
Catalog Number	AR0052BD
Chemical Name	Pyridine,2-chloro-4,6-bis(trifluoromethyl)-
CAS Number	81565-21-1
Molecular Formula	C7H2ClF6N
Molecular Weight	249.5409
MDL Number	MFCD00082557
SMILES	Clc1cc(cc(n1)C(F)(F)F)C(F)(F)F

2-Chloro-4,6-bis(trifluoromethyl)pyridine, commonly known as $name$, is a versatile compound widely utilized in chemical synthesis. One of its primary applications lies in the field of organic chemistry, where it serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and functional materials. This compound's unique structure, characterized by the presence of both chloro and trifluoromethyl substituents on a pyridine ring, imparts specific reactivity and properties that are crucial for the development of complex molecules. In particular, $name$ is valued for its ability to participate in cross-coupling reactions, nucleophilic substitutions, and aromatic transformations, making it a valuable tool for synthetic chemists seeking to introduce fluorinated motifs into their target molecules. Its strategic incorporation into synthetic pathways enables the production of novel compounds with enhanced biological activities, improved chemical properties, and greater stability. By harnessing the synthetic potential of 2-Chloro-4,6-bis(trifluoromethyl)pyridine, researchers can efficiently access diverse molecular architectures that hold promise for applications in drug discovery, material science, and fine chemical synthesis.