
Catalog Number	AR008LW0
Chemical Name	6-Azabicyclo[3.1.0]hexane, 6-[(4-methylphenyl)sulfonyl]-
CAS Number	81097-48-5
Molecular Formula	C12H15NO2S
Molecular Weight	237.3180
MDL Number	MFCD02852961
SMILES	Cc1ccc(cc1)S(=O)(=O)N1C2C1CCC2

6-Tosyl-6-azabicyclo[3.1.0]hexane, also known as TACH, is a versatile chemical compound widely used in chemical synthesis. This bicyclic compound serves as an essential building block in organic chemistry due to its unique structural features and reactivity. In chemical synthesis, 6-Tosyl-6-azabicyclo[3.1.0]hexane finds applications in various transformations and reactions, making it a valuable tool for the creation of diverse molecular structures.One common application of 6-Tosyl-6-azabicyclo[3.1.0]hexane is as a substrate for ring-opening reactions, where its strained bicyclic skeleton facilitates the formation of complex products with high stereochemical control. By exploiting the reactivity of the tosyl group and the nitrogen bridgehead position, chemists can functionalize 6-Tosyl-6-azabicyclo[3.1.0]hexane to introduce diverse functional groups, enabling the synthesis of novel compounds with specific properties.Furthermore, the presence of the tosyl group in 6-Tosyl-6-azabicyclo[3.1.0]hexane allows for selective transformations through its ability to act as a leaving group in various substitution reactions. This characteristic makes TACH a valuable precursor for the synthesis of heterocyclic compounds, natural products, and pharmaceutical intermediates.Overall, the unique structure and reactivity of 6-Tosyl-6-azabicyclo[3.1.0]hexane make it a powerful tool in chemical synthesis, offering chemists a versatile building block to access diverse molecular frameworks and explore new synthetic pathways.