
Catalog Number	AR005K12
Chemical Name	Benzenemethanol,3,4-dinitro-
CAS Number	79544-31-3
Molecular Formula	C7H6N2O5
Molecular Weight	198.1329
MDL Number	MFCD00007094
SMILES	OCc1ccc(c(c1)[N+](=O)[O-])[N+](=O)[O-]

3,4-Dinitrobenzenemethanol is a versatile compound used in various chemical synthesis applications. With its unique chemical structure, this compound serves as a valuable building block in the creation of complex organic molecules. In particular, 3,4-Dinitrobenzenemethanol is commonly employed as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals.One significant application of 3,4-Dinitrobenzenemethanol is in the production of dyes and pigments. Its reactivity allows for the introduction of functional groups that impart specific colors and properties to the final product. Additionally, this compound is utilized in the manufacturing of specialty chemicals, where its ability to undergo various chemical transformations proves essential in the synthesis of advanced materials.Furthermore, 3,4-Dinitrobenzenemethanol plays a crucial role in the development of novel organic compounds with diverse applications. By incorporating this compound into synthetic routes, chemists can tailor the structure and properties of the final products to suit specific industrial or research needs. Its presence in the chemical synthesis toolbox highlights its importance as a valuable resource for creating innovative molecules with tailored functionalities.