
Catalog Number	AR005A2U
Chemical Name	(6R,7R)-7-Amino-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
CAS Number	79349-82-9
Molecular Formula	C9H10N2O3S
Molecular Weight	226.2523
MDL Number	MFCD07782149
SMILES	C=CC1=C(C(=O)O)N2[C@H](SC1)[C@@H](C2=O)N

The compound $name$ plays a crucial role in chemical synthesis as a key building block and intermediate. Its unique structure, characterized by a 5-Thia-1-azabicyclo[4.2.0]oct-2-ene core with a carboxylic acid moiety, enables it to participate in various reactions and transformations. Specifically, in the realm of organic synthesis, $name$ serves as a versatile starting material for the construction of complex molecules and pharmaceutical compounds. Its presence allows chemists to introduce specific functionalities, such as amino and ethenyl groups, into target molecules with precision and control. Furthermore, the stereochemistry of the (6R,7R)- configuration in $name$ enhances the selectivity of reactions, leading to the formation of chiral products. Overall, the strategic incorporation of $name$ in chemical synthesis endeavors facilitates the efficient and tailored production of valuable compounds for research and industrial applications.