
Catalog Number	AR003DD1
Chemical Name	Z-Tic-OH
CAS Number	79261-58-8
Molecular Formula	C18H17NO4
Molecular Weight	311.3319
MDL Number	MFCD00672545
SMILES	OC(=O)[C@@H]1Cc2ccccc2CN1C(=O)OCc1ccccc1

Z-Tic-OH, also known as Z-Ticarpenoyl-OH, is a valuable compound widely utilized in chemical synthesis for its unique properties. This compound serves as a versatile building block in the creation of various organic molecules and can be incorporated into the synthesis of pharmaceuticals, agrochemicals, and materials.One significant application of Z-Tic-OH in chemical synthesis is its role as a key intermediate in the production of bioactive compounds. By utilizing Z-Tic-OH as a starting material, chemists can access diverse chemical structures and synthesize complex molecules with specific biological activities. This compound's structural characteristics make it a valuable precursor for the modification and functionalization of organic molecules, enabling the creation of new compounds with enhanced properties.Additionally, Z-Tic-OH is often employed as a chiral building block in asymmetric synthesis. Its stereochemical properties enable the creation of enantiomerically pure compounds, which are crucial for the development of pharmaceuticals and other high-value products. By incorporating Z-Tic-OH into asymmetric reactions, chemists can access chiral molecules with high selectivity and efficiency, facilitating the production of optically active compounds with precise stereochemistry.Overall, the application of Z-Tic-OH in chemical synthesis offers a wide range of possibilities for the creation of novel compounds with diverse functionalities and applications. From serving as a key intermediate in the synthesis of bioactive molecules to enabling asymmetric transformations, this compound plays a crucial role in advancing the field of organic chemistry and facilitating the development of innovative materials and pharmaceuticals.