
Catalog Number	AR008NRD
Chemical Name	1-BOC-4-(3-bromophenoxy)piperidine
CAS Number	790667-54-8
Molecular Formula	C16H22BrNO3
Molecular Weight	356.2548
MDL Number	MFCD12026057
SMILES	Brc1cccc(c1)OC1CCN(CC1)C(=O)OC(C)(C)C

The tert-Butyl 4-(3-bromophenoxy)piperidine-1-carboxylate is a valuable compound in chemical synthesis, particularly in the field of pharmaceuticals and organic chemistry. This compound serves as a versatile building block for creating complex molecules with specific structural and functional properties. Its unique structure containing a piperidine ring and a bromophenoxy group makes it a valuable intermediate for designing and synthesizing biologically active compounds. Researchers and chemists utilize tert-Butyl 4-(3-bromophenoxy)piperidine-1-carboxylate in the development of new drugs, agrochemicals, and materials due to its ability to introduce specific functionalities into target molecules. Its application in chemical synthesis enables the creation of diverse molecular structures that can exhibit desired biological or physicochemical properties.