
Catalog Number	AR005BSL
Chemical Name	3-([1,1'-Biphenyl]-4-yl);-3-oxopropanenitrile
CAS Number	78443-35-3
Molecular Formula	C15H11NO
Molecular Weight	221.2539
MDL Number	MFCD02260810
SMILES	N#CCC(=O)c1ccc(cc1)c1ccccc1

The compound $name$ serves as a versatile building block in chemical synthesis, particularly valued for its unique structural characteristics and functional groups. One prominent application of this compound lies in its role as a key intermediate in the synthesis of diverse organic molecules. By leveraging its 3-oxopropanenitrile moiety, $name$ enables the introduction of the cyanide functional group into various chemical frameworks, offering opportunities for further derivatization and structural diversification. Moreover, the presence of the [1,1'-Biphenyl]-4-yl group enhances the compound's reactivity and compatibility with a range of coupling reactions, facilitating its incorporation into complex molecular architectures. Overall, the strategic placement of functional groups in $name$ allows for efficient and controlled manipulation in chemical transformations, making it a valuable tool for synthetic chemists seeking to access novel compounds and materials.