
Catalog Number	AR0055EX
Chemical Name	3-Cyano-N-(1,3-diphenyl-1H-pyrazol-5-yl)benzamide
CAS Number	781652-57-1
Molecular Formula	C23H16N4O
Molecular Weight	364.39934
MDL Number	MFCD12828752
SMILES	N#Cc1cccc(c1)C(=O)Nc1cc(nn1c1ccccc1)c1ccccc1

3-Cyano-N-(1,3-diphenyl-1H-pyrazol-5-yl)benzamide is a versatile compound widely employed in chemical synthesis as a key building block. Due to its unique structure, this compound serves as a valuable intermediate in the synthesis of various organic molecules with diverse applications.In chemical synthesis, 3-Cyano-N-(1,3-diphenyl-1H-pyrazol-5-yl)benzamide acts as a crucial starting material in the production of complex heterocyclic compounds. It participates in a range of reactions such as cyclization, substitution, and condensation processes, allowing for the formation of novel compounds with potentially valuable properties.Furthermore, the presence of the cyano group in 3-Cyano-N-(1,3-diphenyl-1H-pyrazol-5-yl)benzamide enables it to be used as a synthetic precursor for the introduction of various functional groups. This flexibility makes it an essential component in the creation of diverse chemical structures for applications in pharmaceuticals, materials science, and agrochemicals.Overall, the strategic incorporation of 3-Cyano-N-(1,3-diphenyl-1H-pyrazol-5-yl)benzamide in chemical synthesis enables the efficient construction of intricate molecules with tailored properties, making it a valuable tool for synthetic chemists.

3-Cyano-N-(1,3-diphenyl-1H-pyrazol-5-yl)benzamide

781652-57-1

Product Details