
Catalog Number	AR0037BF
Chemical Name	4-(4-(Trifluoromethyl)phenoxy)benzoic acid
CAS Number	78161-82-7
Molecular Formula	C14H9F3O3
Molecular Weight	282.2147
MDL Number	MFCD03840158
SMILES	OC(=O)c1ccc(cc1)Oc1ccc(cc1)C(F)(F)F

4-(4-(Trifluoromethyl)phenoxy)benzoic acid, also known as $name$, is a versatile compound widely utilized in chemical synthesis. Due to its unique chemical structure, this acid plays a crucial role in various chemical reactions and processes.With its trifluoromethyl group and phenoxy moiety, 4-(4-(Trifluoromethyl)phenoxy)benzoic acid is particularly valued in the field of medicinal chemistry for the development of pharmaceuticals. Its presence can enhance the biological activity and improve the pharmacokinetic properties of potential drug candidates. Additionally, this compound can serve as a key building block in the synthesis of advanced materials, such as polymers and specialty chemicals.In organic synthesis, 4-(4-(Trifluoromethyl)phenoxy)benzoic acid acts as a valuable intermediate for the construction of more complex molecules. Its structural features enable the formation of diverse functional groups and allow for the introduction of fluorine atoms, which are known to impart unique properties to organic compounds.Furthermore, this acid can participate in transition metal-catalyzed reactions, facilitating the creation of C-C and C-heteroatom bonds. Its compatibility with various synthetic methodologies makes it a versatile tool for chemists seeking to access novel molecular architectures and improve the efficiency of their synthetic routes.