
Catalog Number	AR008O6P
Chemical Name	5-Amino-1H-indazole-3-carboxylic acid
CAS Number	78155-77-8
Molecular Formula	C8H7N3O2
Molecular Weight	177.1601
MDL Number	MFCD05663987
SMILES	Nc1cc2c(n[nH]c2cc1)C(=O)O

5-Amino-1H-indazole-3-carboxylic acid is a versatile compound widely utilized in chemical synthesis for its key role as a building block in organic chemistry. This compound serves as a crucial intermediate in the synthesis of various pharmaceuticals, agrochemicals, and materials.Its functionality as a primary amine and carboxylic acid group allows for a range of synthetic pathways, making it valuable in the development of new compounds. In particular, 5-Amino-1H-indazole-3-carboxylic acid is often employed as a starting material for the construction of heterocyclic structures and peptide derivatives.Furthermore, its unique structural features and reactivity have enabled its use in the preparation of complex molecules with diverse biological activities. By incorporating 5-Amino-1H-indazole-3-carboxylic acid into synthetic routes, chemists can access a wide array of functionalized products with tailored properties for various applications.Overall, the significance of 5-Amino-1H-indazole-3-carboxylic acid in chemical synthesis lies in its pivotal role as a versatile precursor, facilitating the creation of novel compounds with potential therapeutic, agricultural, or materials science applications.