
Catalog Number	AR00FH78
Chemical Name	5-Amino-1H-indazole-3-carboxylic acid methyl ester
CAS Number	660411-95-0
Molecular Formula	C9H9N3O2
Molecular Weight	191.1867
MDL Number	MFCD07371581
SMILES	COC(=O)c1n[nH]c2c1cc(N)cc2

Methyl 5-amino-1H-indazole-3-carboxylate, a versatile compound in chemical synthesis, serves as a key building block in the creation of various organic molecules. With its unique structure and reactivity, this compound plays a crucial role in the synthesis of pharmaceuticals, agrochemicals, and materials in the field of organic chemistry. By serving as a precursor in the formation of complex molecular structures, Methyl 5-amino-1H-indazole-3-carboxylate enables the synthesis of diverse compounds with specific properties and functions, making it an essential component in the development of new and innovative chemical products.