
Catalog Number	AR003SDH
Chemical Name	Methyl 2-methoxy-6-nitrobenzoate
CAS Number	77901-52-1
Molecular Formula	C9H9NO5
Molecular Weight	211.1715
MDL Number	MFCD11656789
SMILES	COC(=O)c1c(OC)cccc1[N+](=O)[O-]

Methyl 2-methoxy-6-nitrobenzoate can be widely utilized as a key building block in chemical synthesis processes. This compound is known for its significance in the creation of various organic compounds due to its unique chemical properties. In chemical synthesis, Methyl 2-methoxy-6-nitrobenzoate serves as a versatile intermediate that facilitates the formation of complex molecules through diverse reaction pathways. Its reactivity allows for the introduction of specific functional groups, enabling chemists to tailor the molecular structure according to desired properties. By incorporating Methyl 2-methoxy-6-nitrobenzoate into synthetic pathways, chemists can efficiently access a wide range of derivatives with varying applications in pharmaceuticals, agrochemicals, and materials science.