
Catalog Number	AR005GQ7
Chemical Name	2,4,8-Trichloropyrimido[5,4-d]pyrimidine
CAS Number	77776-68-2
Molecular Formula	C6HCl3N4
Molecular Weight	235.45794
MDL Number	MFCD16251082
SMILES	Clc1nc(Cl)c2c(n1)c(Cl)ncn2
NSC Number	96655

2,4,8-trichloropyrimido[5,4-d]pyrimidine is a versatile chemical compound commonly used in chemical synthesis due to its unique reactivity and structural characteristics. This compound serves as a valuable building block in the preparation of various pharmaceuticals, agrochemicals, and functional materials. With its three chlorine atoms strategically positioned on the pyrimidine ring, 2,4,8-trichloropyrimido[5,4-d]pyrimidine facilitates selective functionalization reactions, enabling the synthesis of complex molecular structures with high precision. Its reactivity towards a wide range of nucleophiles and electrophiles makes it an essential component in the production of advanced organic compounds with diverse applications.

2,4,8-Trichloropyrimido[5,4-d]pyrimidine

77776-68-2

Product Details