
Catalog Number	AR003DG3
Chemical Name	Benzoic acid, 3-amino-4-borono-, 1-methyl ester (9CI)
CAS Number	774530-27-7
Molecular Formula	C8H10BNO4
Molecular Weight	194.9803
MDL Number	MFCD02179462
SMILES	COC(=O)c1ccc(c(c1)N)B(O)O

(2-Amino-4-(methoxycarbonyl)phenyl)boronic acid, commonly known as $name$, is a versatile compound widely used in chemical synthesis. This compound plays a crucial role as a key building block in the preparation of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, $name$ serves as a valuable reagent for Suzuki-Miyaura cross-coupling reactions, where it participates in the formation of carbon-carbon bonds. This reaction is widely utilized in the synthesis of complex organic molecules and is essential in medicinal chemistry for the construction of bioactive compounds.Moreover, $name$ is often used as a ligand in transition metal-catalyzed coupling reactions due to its boronic acid functionality, which enables coordination with metal catalysts. This ability enhances the reactivity and selectivity of the overall transformation, making it a key component in various organic transformations.Additionally, the presence of the amino and methoxycarbonyl groups in $name$ provides opportunities for further derivatization, allowing chemists to tailor its structure for specific applications. This flexibility makes $name$ a valuable tool in the hands of synthetic chemists for the efficient construction of diverse and complex molecular architectures.Overall, the application of (2-Amino-4-(methoxycarbonyl)phenyl)boronic acid in chemical synthesis highlights its significance in driving innovation and advancement in organic chemistry, particularly in the development of new pharmaceuticals and functional materials.

Benzoic acid, 3-amino-4-borono-, 1-methyl ester (9CI)

774530-27-7

Product Details