
Catalog Number	AR008NYQ
Chemical Name	p-O-Desmethyl Verapamil
CAS Number	77326-93-3
Molecular Formula	C26H36N2O4
Molecular Weight	440.575
SMILES	COc1cc(ccc1OC)C(C(C)C)(CCCN(CCc1ccc(c(c1)OC)O)C)C#N

p-O-Desmethyl Verapamil, commonly referred to as norverapamil, plays a crucial role in chemical synthesis as a versatile pharmaceutical intermediate. Its application in organic chemistry revolves around its ability to undergo various chemical transformations to produce valuable derivatives and analogs.Norverapamil serves as a key building block in the synthesis of novel drugs and therapeutic agents due to its structural similarity to the calcium channel blocker verapamil. By harnessing its chemical reactivity, researchers can modify its functional groups to create new molecules with enhanced pharmacological properties or improved bioavailability.Furthermore, in the field of medicinal chemistry, p-O-Desmethyl Verapamil is utilized to explore structure-activity relationships (SAR) and develop new drug candidates with targeted biological activities. Through strategic modifications and derivatization strategies, it is possible to fine-tune the pharmacokinetic and pharmacodynamic profiles of compounds, ultimately leading to the discovery of more potent and selective pharmaceuticals.In summary, the use of p-O-Desmethyl Verapamil in chemical synthesis offers a platform for innovation and advancement in drug discovery, providing researchers with a valuable tool for designing and synthesizing compounds with diverse therapeutic applications.