
Catalog Number	AR005QQK
Chemical Name	Ethyl 8-cyano-4-hydroxy-3-quinolinecarboxylate
CAS Number	77156-79-7
Molecular Formula	C13H10N2O3
Molecular Weight	242.2301
MDL Number	MFCD00173411
SMILES	CCOC(=O)c1c[nH]c2c(c1=O)cccc2C#N

Ethyl 8-cyano-4-hydroxy-3-quinolinecarboxylate is a versatile compound commonly used in chemical synthesis. Its unique chemical structure makes it an essential building block in the production of pharmaceuticals, agrochemicals, and specialty chemicals. This compound is often employed as a key intermediate in the synthesis of various heterocyclic compounds, such as quinolines and quinolones, which are widely used in medicinal chemistry. Its cyano and hydroxy functional groups allow for diverse chemical modifications, enabling the creation of new compounds with desired properties.In addition, Ethyl 8-cyano-4-hydroxy-3-quinolinecarboxylate serves as a valuable precursor for the synthesis of complex molecules with potent biological activities. Its incorporation in synthetic pathways leads to the formation of structurally diverse compounds that exhibit a range of pharmacological effects, making it a valuable tool for drug discovery and development.Overall, the application of Ethyl 8-cyano-4-hydroxy-3-quinolinecarboxylate in chemical synthesis plays a crucial role in the preparation of bioactive compounds with potential applications in various industries.