
Catalog Number	AR01DUE2
Chemical Name	3-Quinolinecarboxylic acid, 4-hydroxy-6-(1-methylethyl)-, ethyl ester
CAS Number	64321-61-5
Molecular Formula	C15H17NO3
Molecular Weight	259.3004
MDL Number	MFCD24862198
SMILES	CCOC(=O)c1c[nH]c2c(c1=O)cc(cc2)C(C)C

3-Quinolinecarboxylic acid, 4-hydroxy-6-(1-methylethyl)-, ethyl ester is a versatile compound widely utilized in chemical synthesis. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals due to its unique chemical properties and reactivity. In organic synthesis, it acts as a valuable intermediate in the preparation of diverse drug molecules, such as anticancer agents, antibiotics, and antiviral medications. Additionally, this compound is employed in the synthesis of novel materials, dyes, and fine chemicals, contributing to the advancement of multiple industries. Its ability to undergo various chemical transformations makes it a crucial component in the development of innovative products with significant applications in research and development.