
Catalog Number	AR0057X9
Chemical Name	3-(4-Bromophenyl)piperidine-1-carboxylic acid tert-butyl ester
CAS Number	769944-73-2
Molecular Formula	C16H22BrNO2
Molecular Weight	340.2554
MDL Number	MFCD11223610
SMILES	Brc1ccc(cc1)C1CCCN(C1)C(=O)OC(C)(C)C

1-Boc-3-(4-Bromophenyl)piperidine is a versatile compound often employed in chemical synthesis due to its unique properties and reactivity. This compound serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. In organic chemistry, it is frequently utilized as a key intermediate in the synthesis of complex molecules, particularly in the formation of heterocycles and substituted piperidines.Its Boc (tert-butoxycarbonyl) protecting group offers strategic protection for the amine functionality, allowing for selective manipulation of other reactive sites within a molecule. This feature is crucial in multistep synthetic sequences where control over regioselectivity and functional group compatibility is essential. The presence of the 4-bromophenyl moiety further enhances the compound's utility by providing a handle for cross-coupling reactions, such as Suzuki-Miyaura and Heck couplings, enabling the introduction of diverse substituents with high efficiency.Additionally, 1-Boc-3-(4-Bromophenyl)piperidine exhibits good stability under mild reaction conditions, making it suitable for a wide range of transformations without undesired side reactions. Its structural complexity and stereochemical properties make it an attractive candidate for the construction of enantiomerically pure compounds through asymmetric synthesis strategies. Overall, the strategic incorporation of 1-Boc-3-(4-Bromophenyl)piperidine in chemical synthesis facilitates the expedient construction of intricate molecular frameworks with high synthetic efficiency and control.