
Catalog Number	AR005UTB
Chemical Name	Famotidine Related Compound A Hydrochloride
CAS Number	76833-47-1
Molecular Formula	C8H14N6S2
Molecular Weight	258.367
MDL Number	MFCD27966910
SMILES	NC(=N)CCSCc1csc(n1)N=C(N)N

Propanimidamide, 3-[[[2-[(aminoiminomethyl)amino]-4-thiazolyl]methyl]thio]-, hydrochloride (1:1) is a valuable compound in chemical synthesis due to its versatile applications. In organic chemistry, it serves as a key reagent for the synthesis of various compounds, particularly thiazole derivatives. The amino groups present in the molecule play a crucial role in facilitating multiple reactions, such as amidation, acylation, and condensation reactions. Additionally, the thiazole moiety contributes to the formation of heterocyclic structures, making it useful in the synthesis of pharmaceuticals, agrochemicals, and materials with enhanced properties.By incorporating Propanimidamide, 3-[[[2-[(aminoiminomethyl)amino]-4-thiazolyl]methyl]thio]-, hydrochloride (1:1) into chemical reactions, researchers can access a diverse array of products with unique structures and functionalities. Its ability to act as a nucleophile or electrophile provides opportunities for building complex molecular architectures efficiently. Furthermore, the presence of sulfur in the molecule allows for the introduction of sulfur-containing functional groups, broadening the scope of potential applications in organic synthesis.

Famotidine Related Compound A Hydrochloride

76833-47-1

Product Details