
Catalog Number	AR005J7R
Chemical Name	(5-METHYL-2-OXO-1,3-BENZOXAZOL-3(2H)-YL)ACETIC ACID
CAS Number	767304-83-6
Molecular Formula	C10H9NO4
Molecular Weight	207.1828
MDL Number	MFCD04358106
SMILES	OC(=O)Cn1c(=O)oc2c1cc(C)cc2

The (5-Methyl-2-oxo-1,3-benzoxazol-3(2H)-yl)acetic acid is a versatile compound that finds extensive application in chemical synthesis. As a key intermediate in organic reactions, it serves as a precursor for the synthesis of various pharmaceuticals, agrochemicals, and functional materials. Its ability to undergo diverse chemical transformations makes it a valuable building block for creating intricate molecular structures with specific properties. By participating in condensation, substitution, and addition reactions, this compound enables the assembly of complex organic molecules with precision and efficiency. As a result, (5-Methyl-2-oxo-1,3-benzoxazol-3(2H)-yl)acetic acid plays a crucial role in the synthesis of a wide range of compounds across different industries.

(5-METHYL-2-OXO-1,3-BENZOXAZOL-3(2H)-YL)ACETIC ACID

767304-83-6

Product Details