
Catalog Number	AR005LGE
Chemical Name	2-Oxiranecarboxylicacid, 3,3-diphenyl-, methyl ester
CAS Number	76527-25-8
Molecular Formula	C16H14O3
Molecular Weight	254.2806
MDL Number	MFCD09833705
SMILES	COC(=O)C1OC1(c1ccccc1)c1ccccc1

2-Oxiranecarboxylic acid, 3,3-diphenyl-, methyl ester is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This compound is commonly employed as a building block in the synthesis of various organic molecules, particularly in the field of medicinal chemistry and material science.In chemical synthesis, 2-Oxiranecarboxylic acid, 3,3-diphenyl-, methyl ester serves as a valuable precursor for the introduction of functional groups and structural motifs into target molecules. Its epoxide functional group allows for efficient ring-opening reactions, enabling the creation of complex molecular structures with high stereochemical control.Furthermore, the presence of the phenyl groups in the molecule imparts specific reactivity and steric effects, influencing the outcome of subsequent chemical transformations. This makes 2-Oxiranecarboxylic acid, 3,3-diphenyl-, methyl ester a key intermediate in the synthesis of pharmaceutical compounds, natural products, and advanced materials.Overall, the application of 2-Oxiranecarboxylic acid, 3,3-diphenyl-, methyl ester in chemical synthesis offers chemists a powerful tool for designing and synthesizing novel organic molecules with tailored functionalities and properties.