
Catalog Number	AR0036XC
Chemical Name	2-Chloro-4,6-di-4-morpholinyl-1,3,5-triazine
CAS Number	7597-22-0
Molecular Formula	C11H16ClN5O2
Molecular Weight	285.73
MDL Number	MFCD00432885
SMILES	Clc1nc(nc(n1)N1CCOCC1)N1CCOCC1

2-Chloro-4,6-di-4-morpholinyl-1,3,5-triazine, commonly referred to as $name$, is a versatile compound widely used in chemical synthesis. Its unique structure makes it an essential building block for the synthesis of various organic compounds. One notable application of 2-Chloro-4,6-di-4-morpholinyl-1,3,5-triazine is in the field of medicinal chemistry, where it serves as a key intermediate for the creation of pharmaceutical agents.In chemical synthesis, 2-Chloro-4,6-di-4-morpholinyl-1,3,5-triazine plays a crucial role as a reagent in the formation of heterocyclic compounds. Its functional groups enable it to participate in a range of reactions, such as nucleophilic substitution and condensation reactions, leading to the synthesis of complex molecular structures. Additionally, the presence of chlorine and morpholine groups provides opportunities for further derivatization, allowing for the customization of the final products for specific applications.Overall, the incorporation of 2-Chloro-4,6-di-4-morpholinyl-1,3,5-triazine in chemical synthesis enhances the efficiency and diversity of organic synthesis processes, making it a valuable tool for researchers and chemists in the development of new materials, pharmaceuticals, and other chemical compounds.