
Catalog Number	AR005B1D
Chemical Name	1-Nitroadamantane
CAS Number	7575-82-8
Molecular Formula	C10H15NO2
Molecular Weight	181.2316
MDL Number	MFCD01321099
SMILES	[O-][N+](=O)C12CC3CC(C2)CC(C1)C3

1-Nitroadamantane, also known as adamantyl nitro or ANA, is a versatile compound that finds extensive application in chemical synthesis. Due to its unique molecular structure, 1-Nitroadamantane serves as a valuable building block in the synthesis of various organic compounds, especially pharmaceutical intermediates.One of the primary uses of 1-Nitroadamantane in chemical synthesis is as a precursor in the preparation of other functionalized adamantane derivatives. By utilizing nucleophilic substitution reactions, 1-Nitroadamantane can be transformed into a wide range of substituted adamantanes, which possess diverse properties and applications in the field of medicinal chemistry.Furthermore, 1-Nitroadamantane is employed in the synthesis of nitroalkanes and other nitro-containing compounds through different synthetic routes. These nitro compounds are essential intermediates in the production of numerous pharmaceuticals, agrochemicals, and materials with specific functionalities.Overall, the strategic use of 1-Nitroadamantane as a key reagent in various synthetic transformations highlights its significance in the realm of chemical synthesis, enabling the efficient construction of complex organic molecules with tailored structures and properties for diverse applications in research and industry.