
Catalog Number	AR008OIN
Chemical Name	L-Proline,1-[(2S)-3-mercapto-2-methyl-1-oxopropyl]-4-(phenylthio)-, (4S)-
CAS Number	75176-37-3
Molecular Formula	C15H19NO3S2
Molecular Weight	325.4463
MDL Number	MFCD00865919
SMILES	SC[C@@H](C(=O)N1C[C@H](C[C@H]1C(=O)O)Sc1ccccc1)C

Zofenoprilat is a potent angiotensin-converting enzyme (ACE) inhibitor that plays a crucial role in chemical synthesis. This compound is widely utilized in the pharmaceutical industry for the synthesis of various drugs due to its ability to inhibit ACE activity effectively. By incorporating Zofenoprilat into chemical reactions, chemists can modulate the activity of ACE and influence biochemical pathways, making it an indispensable tool in drug discovery and development. Additionally, Zofenoprilat's unique chemical properties make it a valuable building block for the creation of novel drug molecules with enhanced therapeutic effects. Its application in chemical synthesis underscores its significance in advancing pharmaceutical research and innovation.