
Catalog Number	AR005SVQ
Chemical Name	α-Carotene
CAS Number	7488-99-5
Molecular Formula	C39H54
Molecular Weight	522.8461
MDL Number	MFCD00136012
SMILES	CC(=CC=CC=C(C=CC=C(C=CC1C(=CCCC1(C)C)C)C)C)C=CC=CC=CC1=C(C)CCCC1(C)C

1,3,3-Trimethyl-2-((1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-((R)-2,6,6-trimethylcyclohex-2-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl)cyclohex-1-ene is commonly utilized in chemical synthesis as a versatile building block for various organic compounds. Its unique structure and functional groups make it a valuable intermediate in the preparation of complex molecules, particularly in the field of natural product synthesis and medicinal chemistry. This compound serves as a key starting material for the synthesis of diverse chemical derivatives, enabling the creation of novel compounds with potential applications in pharmaceuticals, materials science, and agrochemicals. Its strategic placement of substituents allows for efficient manipulation of its chemical reactivity, facilitating the synthesis of structurally intricate molecules with specific stereochemical arrangements and functional group patterns.

α-Carotene

7488-99-5

Product Details