
Catalog Number	AR003KQN
Chemical Name	4-(4-(4-Methoxyphenyl)piperazin-1-yl)aniline
CAS Number	74852-62-3
Molecular Formula	C17H21N3O
Molecular Weight	283.36814000000004
MDL Number	MFCD09701292
SMILES	COc1ccc(cc1)N1CCN(CC1)c1ccc(cc1)N

4-(4-(4-Methoxyphenyl)piperazin-1-yl)aniline is a versatile compound commonly used in chemical synthesis for its valuable applications in drug discovery and development. This compound serves as a key building block in the creation of various pharmaceutical agents and bioactive molecules. Its unique structure containing both a piperazine and an aniline moiety enables it to participate in a wide range of chemical reactions, making it a valuable tool for medicinal chemistry research.In chemical synthesis, 4-(4-(4-Methoxyphenyl)piperazin-1-yl)aniline can be utilized to introduce functional groups, modify molecular structures, and enhance the biological activity of potential drug candidates. Its presence in a molecule can influence its pharmacokinetic properties, such as solubility, stability, and bioavailability. This compound's ability to interact with specific molecular targets in the body makes it a promising candidate for the design and development of new therapeutic agents.Additionally, the incorporation of 4-(4-(4-Methoxyphenyl)piperazin-1-yl)aniline into drug molecules can lead to improved selectivity, potency, and efficacy, thereby offering new possibilities for the treatment of various diseases. Its role in chemical synthesis highlights its importance in the discovery of innovative medications and underscores its potential to contribute to advancements in the field of pharmaceutical science.